C17H24N2O — CID 143437550
1-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]ethanone (PubChem CID 143437550) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 143437550 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC(N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-14(20)15-4-6-16(7-5-15)19-12-8-17(9-13-19)18-10-2-3-11-18/h4-7,17H,2-3,8-13H2,1H3 |
| InChIKey | VVHXARJZXQZHDA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |