C26H25N5O2S — CID 57035155
benzotriazol-1-yl-[4-[5-(4-pentoxyphenyl)-5H-thiadiazol-2-yl]phenyl]methanone (PubChem CID 57035155) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is benzotriazol-1-yl-[4-[5-(4-pentoxyphenyl)-5H-thiadiazol-2-yl]phenyl]methanone.
| Compound Name | benzotriazol-1-yl-[4-[5-(4-pentoxyphenyl)-5H-thiadiazol-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 57035155 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | benzotriazol-1-yl-[4-[5-(4-pentoxyphenyl)-5H-thiadiazol-2-yl]phenyl]methanone |
| SMILES | CCCCCOc1ccc(C2C=NN(c3ccc(C(=O)n4nnc5ccccc54)cc3)S2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c1-2-3-6-17-33-22-15-11-19(12-16-22)25-18-27-31(34-25)21-13-9-20(10-14-21)26(32)30-24-8-5-4-7-23(24)28-29-30/h4-5,7-16,18,25H,2-3,6,17H2,1H3 |
| InChIKey | WKCHYBLJFBDHES-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|