C23H34N6O8 — CID 139080095
benzene-1,3,5-tricarboxylic acid;1-[10-(1,2,4-triazol-1-yl)decyl]-1,2,4-triazole;dihydrate (PubChem CID 139080095) has the molecular formula C23H34N6O8 and a molecular weight of 522.56 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;1-[10-(1,2,4-triazol-1-yl)decyl]-1,2,4-triazole;dihydrate.
| Compound Name | benzene-1,3,5-tricarboxylic acid;1-[10-(1,2,4-triazol-1-yl)decyl]-1,2,4-triazole;dihydrate |
|---|---|
| PubChem CID | 139080095 |
| Molecular Formula | C23H34N6O8 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;1-[10-(1,2,4-triazol-1-yl)decyl]-1,2,4-triazole;dihydrate |
| SMILES | O.O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.c1ncn(CCCCCCCCCCn2cncn2)n1 |
| InChI | InChI=1S/C14H24N6.C9H6O6.2H2O/c1(3-5-7-9-19-13-15-11-17-19)2-4-6-8-10-20-14-16-12-18-20;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;;/h11-14H,1-10H2;1-3H,(H,10,11)(H,12,13)(H,14,15);2*1H2 |
| InChIKey | OFYBVBBLUYTDHZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 236.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|