C8H15N3O3S — CID 140992909
2-methyl-5-(1,2,4-triazol-1-yl)pentane-2-sulfonic acid (PubChem CID 140992909) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-methyl-5-(1,2,4-triazol-1-yl)pentane-2-sulfonic acid.
| Compound Name | 2-methyl-5-(1,2,4-triazol-1-yl)pentane-2-sulfonic acid |
|---|---|
| PubChem CID | 140992909 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-methyl-5-(1,2,4-triazol-1-yl)pentane-2-sulfonic acid |
| SMILES | CC(C)(CCCn1cncn1)S(=O)(=O)O |
| InChI | InChI=1S/C8H15N3O3S/c1-8(2,15(12,13)14)4-3-5-11-7-9-6-10-11/h6-7H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | WXSNKWHEEGOHLC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|