C9H13N3O3 — CID 139677571
3-(1,2,4-triazol-1-yl)propyl 3-oxobutanoate (PubChem CID 139677571) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)propyl 3-oxobutanoate.
| Compound Name | 3-(1,2,4-triazol-1-yl)propyl 3-oxobutanoate |
|---|---|
| PubChem CID | 139677571 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)propyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCCn1cncn1 |
| InChI | InChI=1S/C9H13N3O3/c1-8(13)5-9(14)15-4-2-3-12-7-10-6-11-12/h6-7H,2-5H2,1H3 |
| InChIKey | RQXIKAPCTWTOCB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|