C11H17N3O6Si — CID 59630478
[bis(3-methyldioxiran-3-yl)-[3-(1,2,4-triazol-1-yl)propyl]silyl] acetate (PubChem CID 59630478) has the molecular formula C11H17N3O6Si and a molecular weight of 315.36 g/mol. Its IUPAC name is [bis(3-methyldioxiran-3-yl)-[3-(1,2,4-triazol-1-yl)propyl]silyl] acetate.
| Compound Name | [bis(3-methyldioxiran-3-yl)-[3-(1,2,4-triazol-1-yl)propyl]silyl] acetate |
|---|---|
| PubChem CID | 59630478 |
| Molecular Formula | C11H17N3O6Si |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [bis(3-methyldioxiran-3-yl)-[3-(1,2,4-triazol-1-yl)propyl]silyl] acetate |
| SMILES | CC(=O)O[Si](CCCn1cncn1)(C1(C)OO1)C1(C)OO1 |
| InChI | InChI=1S/C11H17N3O6Si/c1-9(15)16-21(10(2)17-18-10,11(3)19-20-11)6-4-5-14-8-12-7-13-14/h7-8H,4-6H2,1-3H3 |
| InChIKey | YOGMCDUNGVJBLX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 107.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|