About methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride
methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride (PubChem CID 51051880) has the molecular formula C6H10ClN3O2
and a molecular weight of 191.62 g/mol. Its IUPAC name is methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride.
Analyze methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride?
The IUPAC name of methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride (CID 51051880) is methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride.
What is the SMILES notation for methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride?
The canonical SMILES for methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride is COC(=O)CCn1cncn1.Cl.
What is the InChIKey of methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride?
The InChIKey is BJFXOZOSYSUFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2.ClH/c1-11-6(10)2-3-9-5-7-4-8-9;/h4-5H,2-3H2,1H3;1H.
What are the key properties of methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride?
methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride has a molecular weight of 191.62 g/mol, XLogP of 0.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,2,4-triazol-1-yl)propanoate;hydrochloride is sourced from PubChem (CID 51051880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).