About methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate
methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate (PubChem CID 55148837) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate.
Analyze methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate?
The IUPAC name of methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate (CID 55148837) is methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate.
What is the SMILES notation for methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate?
The canonical SMILES for methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate is CCN(CC(=O)OC)C(=O)Cn1cncn1.
What is the InChIKey of methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate?
The InChIKey is IKKKBDGGPFSTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O3/c1-3-12(5-9(15)16-2)8(14)4-13-7-10-6-11-13/h6-7H,3-5H2,1-2H3.
What are the key properties of methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate?
methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate has a molecular weight of 226.24 g/mol, XLogP of -0.70, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[ethyl-[2-(1,2,4-triazol-1-yl)acetyl]amino]acetate is sourced from PubChem (CID 55148837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).