C12H20N4O3 — CID 43423421
methyl 6-[3-(1,2,4-triazol-1-yl)propanoylamino]hexanoate (PubChem CID 43423421) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is methyl 6-[3-(1,2,4-triazol-1-yl)propanoylamino]hexanoate.
| Compound Name | methyl 6-[3-(1,2,4-triazol-1-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 43423421 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl 6-[3-(1,2,4-triazol-1-yl)propanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCn1cncn1 |
| InChI | InChI=1S/C12H20N4O3/c1-19-12(18)5-3-2-4-7-14-11(17)6-8-16-10-13-9-15-16/h9-10H,2-8H2,1H3,(H,14,17) |
| InChIKey | URWOJGRWSZLBNE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|