C19H16N4O2 — CID 166204348
[4-(4-cyanophenyl)phenyl] 4-(1,2,4-triazol-1-yl)butanoate (PubChem CID 166204348) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 4-(1,2,4-triazol-1-yl)butanoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 4-(1,2,4-triazol-1-yl)butanoate |
|---|---|
| PubChem CID | 166204348 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 4-(1,2,4-triazol-1-yl)butanoate |
| SMILES | N#Cc1ccc(-c2ccc(OC(=O)CCCn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C19H16N4O2/c20-12-15-3-5-16(6-4-15)17-7-9-18(10-8-17)25-19(24)2-1-11-23-14-21-13-22-23/h3-10,13-14H,1-2,11H2 |
| InChIKey | KUFHIAIZPAJXPP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|