C18H15N3O3 — CID 56805508
dibenzofuran-2-yl 4-(1,2,4-triazol-1-yl)butanoate (PubChem CID 56805508) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is dibenzofuran-2-yl 4-(1,2,4-triazol-1-yl)butanoate.
| Compound Name | dibenzofuran-2-yl 4-(1,2,4-triazol-1-yl)butanoate |
|---|---|
| PubChem CID | 56805508 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | dibenzofuran-2-yl 4-(1,2,4-triazol-1-yl)butanoate |
| SMILES | O=C(CCCn1cncn1)Oc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H15N3O3/c22-18(6-3-9-21-12-19-11-20-21)23-13-7-8-17-15(10-13)14-4-1-2-5-16(14)24-17/h1-2,4-5,7-8,10-12H,3,6,9H2 |
| InChIKey | FOZOSZUUNZMTCM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|