C19H15NO4S — CID 55536611
dibenzofuran-2-yl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate (PubChem CID 55536611) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is dibenzofuran-2-yl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate.
| Compound Name | dibenzofuran-2-yl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 55536611 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | dibenzofuran-2-yl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
| SMILES | Cc1csc(=O)n1CCC(=O)Oc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C19H15NO4S/c1-12-11-25-19(22)20(12)9-8-18(21)23-13-6-7-17-15(10-13)14-4-2-3-5-16(14)24-17/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | ANTVYVFMNVYJFS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|