C16H18ClNO4S — CID 55568503
3-(4-chlorophenoxy)propyl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate (PubChem CID 55568503) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)propyl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate.
| Compound Name | 3-(4-chlorophenoxy)propyl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 55568503 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 3-(4-chlorophenoxy)propyl 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoate |
| SMILES | Cc1csc(=O)n1CCC(=O)OCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO4S/c1-12-11-23-16(20)18(12)8-7-15(19)22-10-2-9-21-14-5-3-13(17)4-6-14/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | MMXOTVCBNBQILJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|