C17H16N2O5S — CID 46606374
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46606374) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46606374 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1csc(=O)n1CCOC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H16N2O5S/c1-11-10-25-17(23)18(11)8-9-24-14(20)6-7-19-15(21)12-4-2-3-5-13(12)16(19)22/h2-5,10H,6-9H2,1H3 |
| InChIKey | YEMRLWLGXCNCRY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|