C14H19N3O5S — CID 46608614
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 46608614) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 46608614 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | Cc1csc(=O)n1CCOC(=O)CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H19N3O5S/c1-9-8-23-13(21)16(9)6-7-22-10(18)4-5-17-11(19)14(2,3)15-12(17)20/h8H,4-7H2,1-3H3,(H,15,20) |
| InChIKey | LYDCRKFQXKESOJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|