C18H13Cl2NO4 — CID 3379267
(2,6-dichlorophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3379267) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (2,6-dichlorophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3379267 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H13Cl2NO4/c19-14-6-3-7-15(20)13(14)10-25-16(22)8-9-21-17(23)11-4-1-2-5-12(11)18(21)24/h1-7H,8-10H2 |
| InChIKey | CQLJHJSDSXZPQL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|