C24H27NO4 — CID 3886159
(4-tert-butyl-2,6-dimethylphenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3886159) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3886159 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H27NO4/c1-15-12-17(24(3,4)5)13-16(2)20(15)14-29-21(26)10-11-25-22(27)18-8-6-7-9-19(18)23(25)28/h6-9,12-13H,10-11,14H2,1-5H3 |
| InChIKey | KWENDMRFLNCKBU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|