C27H27NO4 — CID 3508658
(4-tert-butylphenyl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 3508658) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | (4-tert-butylphenyl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 3508658 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (4-tert-butylphenyl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | CC(C)(C)c1ccc(COC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-27(2,3)20-14-12-18(13-15-20)17-32-23(29)11-6-16-28-25(30)21-9-4-7-19-8-5-10-22(24(19)21)26(28)31/h4-5,7-10,12-15H,6,11,16-17H2,1-3H3 |
| InChIKey | ITQIMGQCRYIERB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|