C16H12NNaO4 — CID 23680122
sodium 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 23680122) has the molecular formula C16H12NNaO4 and a molecular weight of 305.26 g/mol. Its IUPAC name is sodium 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | sodium 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 23680122 |
| Molecular Formula | C16H12NNaO4 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | sodium 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | O=C([O-])CCCN1C(=O)c2cccc3cccc(c23)C1=O.[Na+] |
| InChI | InChI=1S/C16H13NO4.Na/c18-13(19)8-3-9-17-15(20)11-6-1-4-10-5-2-7-12(14(10)11)16(17)21;/h1-2,4-7H,3,8-9H2,(H,18,19);/q;+1/p-1 |
| InChIKey | UAWHLGLAABJANU-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|