C24H28N2O3 — CID 18156103
N-cyclohexyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-ethylbutanamide (PubChem CID 18156103) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-ethylbutanamide.
| Compound Name | N-cyclohexyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-ethylbutanamide |
|---|---|
| PubChem CID | 18156103 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-cyclohexyl-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-ethylbutanamide |
| SMILES | CCN(C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-25(18-11-4-3-5-12-18)21(27)15-8-16-26-23(28)19-13-6-9-17-10-7-14-20(22(17)19)24(26)29/h6-7,9-10,13-14,18H,2-5,8,11-12,15-16H2,1H3 |
| InChIKey | NMRUGELKJJELMK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|