C24H21ClN2O3 — CID 26731693
N-[(4-chlorophenyl)methyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide (PubChem CID 26731693) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 26731693 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C24H21ClN2O3/c1-26(15-16-10-12-18(25)13-11-16)21(28)9-4-14-27-23(29)19-7-2-5-17-6-3-8-20(22(17)19)24(27)30/h2-3,5-8,10-13H,4,9,14-15H2,1H3 |
| InChIKey | MGXMCXRTCMXKPA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|