C25H24N2O3 — CID 43021998
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methyl-N-(1-phenylethyl)butanamide (PubChem CID 43021998) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methyl-N-(1-phenylethyl)butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methyl-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 43021998 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methyl-N-(1-phenylethyl)butanamide |
| SMILES | CC(c1ccccc1)N(C)C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C25H24N2O3/c1-17(18-9-4-3-5-10-18)26(2)22(28)15-8-16-27-24(29)20-13-6-11-19-12-7-14-21(23(19)20)25(27)30/h3-7,9-14,17H,8,15-16H2,1-2H3 |
| InChIKey | CJKFIOKJWGAZMU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|