C26H23N3O3S — CID 16562154
N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide (PubChem CID 16562154) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 16562154 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-methylbutanamide |
| SMILES | CC(c1nc2ccccc2s1)N(C)C(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C26H23N3O3S/c1-16(24-27-20-12-3-4-13-21(20)33-24)28(2)22(30)14-7-15-29-25(31)18-10-5-8-17-9-6-11-19(23(17)18)26(29)32/h3-6,8-13,16H,7,14-15H2,1-2H3 |
| InChIKey | UEKZYVXRMMFKCB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|