C22H24N2O4 — CID 46588371
4-(1,3-dioxoisoindol-2-yl)-N-[1-(2-methoxyphenyl)ethyl]-N-methylbutanamide (PubChem CID 46588371) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[1-(2-methoxyphenyl)ethyl]-N-methylbutanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[1-(2-methoxyphenyl)ethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 46588371 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[1-(2-methoxyphenyl)ethyl]-N-methylbutanamide |
| SMILES | COc1ccccc1C(C)N(C)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H24N2O4/c1-15(16-9-6-7-12-19(16)28-3)23(2)20(25)13-8-14-24-21(26)17-10-4-5-11-18(17)22(24)27/h4-7,9-12,15H,8,13-14H2,1-3H3 |
| InChIKey | QYDCCCLUMRMRDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|