C26H31N3O4 — CID 132674848
4-(1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide (PubChem CID 132674848) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 132674848 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(2-methylphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
| SMILES | Cc1ccccc1CN(C(=O)CCCN1C(=O)c2ccccc2C1=O)C(C)C(=O)NC(C)C |
| InChI | InChI=1S/C26H31N3O4/c1-17(2)27-24(31)19(4)29(16-20-11-6-5-10-18(20)3)23(30)14-9-15-28-25(32)21-12-7-8-13-22(21)26(28)33/h5-8,10-13,17,19H,9,14-16H2,1-4H3,(H,27,31) |
| InChIKey | UODZSFUYCOKEMV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|