C26H30FN3O4 — CID 133226070
N-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 133226070) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is N-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133226070 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1ccccc1F)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H30FN3O4/c1-4-17(2)28-24(32)18(3)30(16-19-10-5-8-13-22(19)27)23(31)14-9-15-29-25(33)20-11-6-7-12-21(20)26(29)34/h5-8,10-13,17-18H,4,9,14-16H2,1-3H3,(H,28,32) |
| InChIKey | WMFCXTLSVCYXRR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|