C32H34FN3O4 — CID 100650272
N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 100650272) has the molecular formula C32H34FN3O4 and a molecular weight of 543.64 g/mol. Its IUPAC name is N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100650272 |
| Molecular Formula | C32H34FN3O4 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H34FN3O4/c1-2-3-19-34-30(38)28(21-23-12-5-4-6-13-23)36(22-24-14-7-10-17-27(24)33)29(37)18-11-20-35-31(39)25-15-8-9-16-26(25)32(35)40/h4-10,12-17,28H,2-3,11,18-22H2,1H3,(H,34,38)/t28-/m1/s1 |
| InChIKey | OKJVCTVKGOODDY-MUUNZHRXSA-N |
| XLogP | 4.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|