C30H34ClFN2O2S — CID 100651815
N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 100651815) has the molecular formula C30H34ClFN2O2S and a molecular weight of 541.13 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100651815 |
| Molecular Formula | C30H34ClFN2O2S |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34ClFN2O2S/c1-2-3-19-33-30(36)28(21-23-10-5-4-6-11-23)34(22-24-12-7-8-13-27(24)32)29(35)14-9-20-37-26-17-15-25(31)16-18-26/h4-8,10-13,15-18,28H,2-3,9,14,19-22H2,1H3,(H,33,36)/t28-/m0/s1 |
| InChIKey | WIPRAJUMHPQVEU-NDEPHWFRSA-N |
| XLogP | 6.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|