C29H34N2O2S — CID 133152410
2-[benzyl(3-phenylsulfanylpropanoyl)amino]-N-butyl-3-phenylpropanamide (PubChem CID 133152410) has the molecular formula C29H34N2O2S and a molecular weight of 474.67 g/mol. Its IUPAC name is 2-[benzyl(3-phenylsulfanylpropanoyl)amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl(3-phenylsulfanylpropanoyl)amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133152410 |
| Molecular Formula | C29H34N2O2S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[benzyl(3-phenylsulfanylpropanoyl)amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C29H34N2O2S/c1-2-3-20-30-29(33)27(22-24-13-7-4-8-14-24)31(23-25-15-9-5-10-16-25)28(32)19-21-34-26-17-11-6-12-18-26/h4-18,27H,2-3,19-23H2,1H3,(H,30,33) |
| InChIKey | PDPMWWVGZPOKHY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|