C30H34Cl2N2O2S — CID 133207357
N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]-3-phenylpropanamide (PubChem CID 133207357) has the molecular formula C30H34Cl2N2O2S and a molecular weight of 557.59 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207357 |
| Molecular Formula | C30H34Cl2N2O2S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCSc1ccc(C)cc1 |
| InChI | InChI=1S/C30H34Cl2N2O2S/c1-3-4-18-33-30(36)28(20-23-9-6-5-7-10-23)34(21-25-26(31)11-8-12-27(25)32)29(35)17-19-37-24-15-13-22(2)14-16-24/h5-16,28H,3-4,17-21H2,1-2H3,(H,33,36) |
| InChIKey | DVBAIJRWLYFBMX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|