C29H32BrClN2O2S — CID 100663406
(2R)-2-[(3-bromophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100663406) has the molecular formula C29H32BrClN2O2S and a molecular weight of 588.01 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100663406 |
| Molecular Formula | C29H32BrClN2O2S |
| Molecular Weight | 588.01 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32BrClN2O2S/c1-2-3-17-32-29(35)27(20-22-8-5-4-6-9-22)33(21-23-10-7-11-24(30)19-23)28(34)16-18-36-26-14-12-25(31)13-15-26/h4-15,19,27H,2-3,16-18,20-21H2,1H3,(H,32,35)/t27-/m1/s1 |
| InChIKey | VXMOIYZCVIGQTE-HHHXNRCGSA-N |
| XLogP | 7.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.01 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|