C26H27BrN2O2S — CID 132620764
2-[(3-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-methyl-3-phenylpropanamide (PubChem CID 132620764) has the molecular formula C26H27BrN2O2S and a molecular weight of 511.49 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132620764 |
| Molecular Formula | C26H27BrN2O2S |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C26H27BrN2O2S/c1-28-26(31)24(18-20-9-4-2-5-10-20)29(19-21-11-8-12-22(27)17-21)25(30)15-16-32-23-13-6-3-7-14-23/h2-14,17,24H,15-16,18-19H2,1H3,(H,28,31) |
| InChIKey | WEJPDOYJLRQGHB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |