C27H29ClN2O2S — CID 100664643
N-benzyl-4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 100664643) has the molecular formula C27H29ClN2O2S and a molecular weight of 481.06 g/mol. Its IUPAC name is N-benzyl-4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-benzyl-4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 100664643 |
| Molecular Formula | C27H29ClN2O2S |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-benzyl-4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H29ClN2O2S/c1-29-27(32)25(19-21-9-4-2-5-10-21)30(20-22-11-6-3-7-12-22)26(31)13-8-18-33-24-16-14-23(28)15-17-24/h2-7,9-12,14-17,25H,8,13,18-20H2,1H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | NYCBDKBAGFOJFD-RUZDIDTESA-N |
| XLogP | 5.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|