C30H34BrClN2O2S — CID 133193159
N-[(4-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 133193159) has the molecular formula C30H34BrClN2O2S and a molecular weight of 602.04 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 133193159 |
| Molecular Formula | C30H34BrClN2O2S |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC(C)(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34BrClN2O2S/c1-30(2,3)33-29(36)27(20-22-8-5-4-6-9-22)34(21-23-11-13-24(31)14-12-23)28(35)10-7-19-37-26-17-15-25(32)16-18-26/h4-6,8-9,11-18,27H,7,10,19-21H2,1-3H3,(H,33,36) |
| InChIKey | NHGVAULFUPYFEX-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|