C24H30BrClN2O2S — CID 133146083
N-[(3-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxopropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 133146083) has the molecular formula C24H30BrClN2O2S and a molecular weight of 525.94 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxopropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxopropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 133146083 |
| Molecular Formula | C24H30BrClN2O2S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[1-(tert-butylamino)-1-oxopropan-2-yl]-4-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1cccc(Br)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H30BrClN2O2S/c1-17(23(30)27-24(2,3)4)28(16-18-7-5-8-19(25)15-18)22(29)9-6-14-31-21-12-10-20(26)11-13-21/h5,7-8,10-13,15,17H,6,9,14,16H2,1-4H3,(H,27,30) |
| InChIKey | GQSJTUIGGTZHPK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|