C26H35ClN2O3S — CID 132618120
N-tert-butyl-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132618120) has the molecular formula C26H35ClN2O3S and a molecular weight of 491.10 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132618120 |
| Molecular Formula | C26H35ClN2O3S |
| Molecular Weight | 491.10 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-tert-butyl-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1cccc(OC)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O3S/c1-6-23(25(31)28-26(2,3)4)29(18-19-9-7-10-21(17-19)32-5)24(30)11-8-16-33-22-14-12-20(27)13-15-22/h7,9-10,12-15,17,23H,6,8,11,16,18H2,1-5H3,(H,28,31) |
| InChIKey | YGVDUFRFTISKQH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.10 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|