C27H35ClN2O3S — CID 132619748
2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide (PubChem CID 132619748) has the molecular formula C27H35ClN2O3S and a molecular weight of 503.11 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132619748 |
| Molecular Formula | C27H35ClN2O3S |
| Molecular Weight | 503.11 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1cccc(OC)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H35ClN2O3S/c1-3-25(27(32)29-22-9-4-5-10-22)30(19-20-8-6-11-23(18-20)33-2)26(31)12-7-17-34-24-15-13-21(28)14-16-24/h6,8,11,13-16,18,22,25H,3-5,7,9-10,12,17,19H2,1-2H3,(H,29,32) |
| InChIKey | VFRNZMFPHIBJPV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.11 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|