C25H33ClN2O3S — CID 132724120
2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-propan-2-ylbutanamide (PubChem CID 132724120) has the molecular formula C25H33ClN2O3S and a molecular weight of 477.07 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-propan-2-ylbutanamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 132724120 |
| Molecular Formula | C25H33ClN2O3S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)N(Cc1cccc(OC)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33ClN2O3S/c1-5-23(25(30)27-18(2)3)28(17-19-8-6-9-21(16-19)31-4)24(29)10-7-15-32-22-13-11-20(26)12-14-22/h6,8-9,11-14,16,18,23H,5,7,10,15,17H2,1-4H3,(H,27,30) |
| InChIKey | JZHYJFRSAGJWSQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|