C26H35ClN2O2S — CID 100675923
(2S)-N-[(2R)-butan-2-yl]-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methylphenyl)methyl]amino]butanamide (PubChem CID 100675923) has the molecular formula C26H35ClN2O2S and a molecular weight of 475.10 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methylphenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100675923 |
| Molecular Formula | C26H35ClN2O2S |
| Molecular Weight | 475.10 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methylphenyl)methyl]amino]butanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H](CC)N(Cc1cccc(C)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O2S/c1-5-20(4)28-26(31)24(6-2)29(18-21-10-7-9-19(3)17-21)25(30)11-8-16-32-23-14-12-22(27)13-15-23/h7,9-10,12-15,17,20,24H,5-6,8,11,16,18H2,1-4H3,(H,28,31)/t20-,24+/m1/s1 |
| InChIKey | DZOVSDPNHKEQAY-YKSBVNFPSA-N |
| XLogP | 6.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.10 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|