C28H37ClN2O3S — CID 100593638
(2R)-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100593638) has the molecular formula C28H37ClN2O3S and a molecular weight of 517.14 g/mol. Its IUPAC name is (2R)-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100593638 |
| Molecular Formula | C28H37ClN2O3S |
| Molecular Weight | 517.14 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | (2R)-2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(3-methoxyphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1cccc(OC)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H37ClN2O3S/c1-3-26(28(33)30-23-10-5-4-6-11-23)31(20-21-9-7-12-24(19-21)34-2)27(32)13-8-18-35-25-16-14-22(29)15-17-25/h7,9,12,14-17,19,23,26H,3-6,8,10-11,13,18,20H2,1-2H3,(H,30,33)/t26-/m1/s1 |
| InChIKey | YOHUDXLEKXQPIM-AREMUKBSSA-N |
| XLogP | 6.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.14 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|