C26H32Cl2N2O2S — CID 100553522
N-[(3-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]butanamide (PubChem CID 100553522) has the molecular formula C26H32Cl2N2O2S and a molecular weight of 507.53 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]butanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 100553522 |
| Molecular Formula | C26H32Cl2N2O2S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]butanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)N(Cc1cccc(Cl)c1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H32Cl2N2O2S/c1-19(26(32)29-23-9-3-2-4-10-23)30(18-20-7-5-8-22(28)17-20)25(31)11-6-16-33-24-14-12-21(27)13-15-24/h5,7-8,12-15,17,19,23H,2-4,6,9-11,16,18H2,1H3,(H,29,32)/t19-/m0/s1 |
| InChIKey | XFLFKFNUHHVGAG-IBGZPJMESA-N |
| XLogP | 6.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|