C26H33ClN2O3 — CID 100551970
N-[(3-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide (PubChem CID 100551970) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 100551970 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)N(Cc1cccc(Cl)c1)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-20(26(31)28-23-12-4-2-5-13-23)29(19-21-10-8-11-22(27)18-21)25(30)16-9-17-32-24-14-6-3-7-15-24/h3,6-8,10-11,14-15,18,20,23H,2,4-5,9,12-13,16-17,19H2,1H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | JBSVBDLYKCWYJD-HXUWFJFHSA-N |
| XLogP | 5.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|