C24H28ClFN2O3 — CID 133263757
2-[(3-chlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 133263757) has the molecular formula C24H28ClFN2O3 and a molecular weight of 446.95 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 133263757 |
| Molecular Formula | C24H28ClFN2O3 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1cccc(Cl)c1)C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C24H28ClFN2O3/c1-17(24(30)27-21-8-3-2-4-9-21)28(15-18-6-5-7-19(25)14-18)23(29)16-31-22-12-10-20(26)11-13-22/h5-7,10-14,17,21H,2-4,8-9,15-16H2,1H3,(H,27,30) |
| InChIKey | RBKZNWDCALGLCO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |