C23H26BrClN2O3 — CID 133196774
2-[(3-bromophenyl)methyl-[2-(4-chlorophenoxy)acetyl]amino]-N-cyclopentylpropanamide (PubChem CID 133196774) has the molecular formula C23H26BrClN2O3 and a molecular weight of 493.83 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(4-chlorophenoxy)acetyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(4-chlorophenoxy)acetyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 133196774 |
| Molecular Formula | C23H26BrClN2O3 |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(4-chlorophenoxy)acetyl]amino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1cccc(Br)c1)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26BrClN2O3/c1-16(23(29)26-20-7-2-3-8-20)27(14-17-5-4-6-18(24)13-17)22(28)15-30-21-11-9-19(25)10-12-21/h4-6,9-13,16,20H,2-3,7-8,14-15H2,1H3,(H,26,29) |
| InChIKey | DDJCXMHWRVONRA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |