C24H28ClFN2O2 — CID 133248539
2-[(3-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 133248539) has the molecular formula C24H28ClFN2O2 and a molecular weight of 430.95 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 133248539 |
| Molecular Formula | C24H28ClFN2O2 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1cccc(Cl)c1)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H28ClFN2O2/c1-17(24(30)27-22-8-3-2-4-9-22)28(16-19-6-5-7-20(25)14-19)23(29)15-18-10-12-21(26)13-11-18/h5-7,10-14,17,22H,2-4,8-9,15-16H2,1H3,(H,27,30) |
| InChIKey | XISRNASRPMKGSE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |