C23H26ClFN2O2 — CID 132947550
2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclopentylpropanamide (PubChem CID 132947550) has the molecular formula C23H26ClFN2O2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 132947550 |
| Molecular Formula | C23H26ClFN2O2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1ccccc1Cl)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26ClFN2O2/c1-16(23(29)26-20-7-3-4-8-20)27(15-18-6-2-5-9-21(18)24)22(28)14-17-10-12-19(25)13-11-17/h2,5-6,9-13,16,20H,3-4,7-8,14-15H2,1H3,(H,26,29) |
| InChIKey | DKCVMCXHQHPFLM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |