C25H30ClFN2O2 — CID 132612259
2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 132612259) has the molecular formula C25H30ClFN2O2 and a molecular weight of 444.98 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132612259 |
| Molecular Formula | C25H30ClFN2O2 |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1Cl)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H30ClFN2O2/c1-2-23(25(31)28-21-9-4-3-5-10-21)29(17-19-8-6-7-11-22(19)26)24(30)16-18-12-14-20(27)15-13-18/h6-8,11-15,21,23H,2-5,9-10,16-17H2,1H3,(H,28,31) |
| InChIKey | KIIPLOXMRQWXRQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |