C20H29ClN2O2 — CID 132761965
2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclohexylbutanamide (PubChem CID 132761965) has the molecular formula C20H29ClN2O2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclohexylbutanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132761965 |
| Molecular Formula | C20H29ClN2O2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclohexylbutanamide |
| SMILES | CCC(=O)N(Cc1ccccc1Cl)C(CC)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O2/c1-3-18(20(25)22-16-11-6-5-7-12-16)23(19(24)4-2)14-15-10-8-9-13-17(15)21/h8-10,13,16,18H,3-7,11-12,14H2,1-2H3,(H,22,25) |
| InChIKey | SKJWTAPCTNQTGN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |