C24H29ClN2O2 — CID 133247823
2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133247823) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133247823 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-propanoylamino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | CCC(=O)N(Cc1ccccc1Cl)C(Cc1ccccc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H29ClN2O2/c1-2-23(28)27(17-19-12-6-9-15-21(19)25)22(16-18-10-4-3-5-11-18)24(29)26-20-13-7-8-14-20/h3-6,9-12,15,20,22H,2,7-8,13-14,16-17H2,1H3,(H,26,29) |
| InChIKey | CEOOWRAQZBNKBT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |