C29H31ClN2O3 — CID 133247502
2-[(2-chlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 133247502) has the molecular formula C29H31ClN2O3 and a molecular weight of 491.03 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133247502 |
| Molecular Formula | C29H31ClN2O3 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(2-phenoxyacetyl)amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C29H31ClN2O3/c30-26-18-10-7-13-23(26)20-32(28(33)21-35-25-16-5-2-6-17-25)27(19-22-11-3-1-4-12-22)29(34)31-24-14-8-9-15-24/h1-7,10-13,16-18,24,27H,8-9,14-15,19-21H2,(H,31,34) |
| InChIKey | BIVRXNCOFITNSO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |